Product Description
Pharmaceutical-grade sodium carboxymethyl cellulose (CMC) is produced from natural cellulose through carefully controlled chemical processing methods, resulting in a pure white, odorless, and tasteless powder with excellent biocompatibility and chemical stability.
High Purity and Safety
Advanced purification processes are used to effectively reduce impurities, while heavy metals, microbial content, and residual solvents are strictly controlled to ensure high biosafety and minimize any potential impact on active pharmaceutical ingredients (APIs).
Properties
| Melting point | 274 °C (dec.) |
| density | 1,6 g/cm3 |
| refractive index | 1.515 |
| FEMA | 2239 | CARBOXYMETHYLCELLULOSE |
| storage temp. | room temp |
| solubility | H2O: 20 mg/mL, soluble |
| pka | 4.30(at 25℃) |
| form | low viscosity |
| color | White to light yellow |
| Odor | Odorless |
| PH | pH (10g/l, 25℃) 6.0～8.0 |
| PH Range | 6.5 - 8.5 |
| biological source | wood (pulp) |
| Water Solubility | soluble |
| Merck | 141829 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | EMULSION STABILISING |
| FRAGRANCE | |
| VISCOSITY CONTROLLING | |
| FILM FORMING | |
| BINDING | |
| Cosmetic Ingredient Review (CIR) | Sodium carboxymethyl cellulose (9004-32-4) |
| InChI | 1S/C6H12O6.C2H4O2.Na/c7-1-3(9)5(11)6(12)4(10)2-8;1-2(3)4;/h1,3-6,8-12H,2H2;1H3,(H,3,4); |
| InChIKey | DPXJVFZANSGRMM-UHFFFAOYSA-N |
| SMILES | [Na].OC(C(O)C(O)C=O)C(O)CO.OC(=O)C |
| EPA Substance Registry System | Sodium carboxymethyl cellulose (9004-32-4) |
| Risk Statements | 40 |
| Safety Statements | 24/25 |
| WGK Germany | 1 |
| RTECS | FJ5950000 |
| F | 3 |
| Autoignition Temperature | 698 °F |
| TSCA | TSCA listed |
| HS Code | 39123100 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 oral in rabbit: > 27gm/kg |
Adjustable Rheological Performance
The product is available in a range of viscosity grades and substitution levels, allowing formulators to accurately optimize viscosity, suspension properties, and drug release performance according to formulation requirements.
Excellent Compatibility
As a highly stable pharmaceutical excipient, it demonstrates good compatibility with most APIs and commonly used excipients without negatively affecting drug stability or efficacy.
Factory Tour
Package And Shipping
