Product Description
Lactose Monohydrate (CAS# 64044-51-5) is a highly purified, crystallized milk sugar. Classified as a disaccharide, it consists of one glucose molecule and one galactose molecule. Presented as a fine white crystalline powder, the product enjoys extensive application across the pharmaceutical, food and chemical industries.
Properties
| Melting point | ~215 °C (dec.) |
| density | 1.525 |
| storage temp. | room temp |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| form | Crystalline |
| Specific Gravity | 1.525 |
| color | White |
| PH | 3.5-6.0 (25℃, 0.5M in H2O) |
| Optical Rotation | [α]22/D +52.4°, c = 4.5 in H2O |
| Water Solubility | Soluble in water (warm) (0.1 g/mL), and ethanol (very slightly soluble). Insoluble in chloroform, and ether. |
| λmax | λ: 260 nm Amax: 0.02 |
| λ: 280 nm Amax: 0.02 | |
| Merck | 145343 |
| BRN | 3768231 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C12H22O11.H2O/c13-1-4(16)7(18)11(5(17)2-14)23-12-10(21)9(20)8(19)6(3-15)22-12;/h1,4-12,14-21H,2-3H2;1H2/t4-,5+,6+,7+,8-,9-,10+,11+,12-;/m0./s1 |
| InChIKey | HBDJFVFTHLOSDW-XBLONOLSSA-N |
| SMILES | O.OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)[C@H](O)[C@@H](O)C=O |
| LogP | -3.409 (est) |
| CAS DataBase Reference | 64044-51-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Lactose monohydrate(64044-51-5) |
| EPA Substance Registry System | Lactose monohydrate (64044-51-5) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| RTECS | OD9625000 |
| F | 3 |
| TSCA | Yes |
| HS Code | 17021900 |
| Storage Class | 11 - Combustible Solids |
Product Application
Lactose Monohydrate serves as a pharmaceutical secondary standard for quality-control purposes, providing pharmaceutical laboratories and manufacturers with a convenient and cost-effective alternative to the preparation of in-house working standards.
Factory Tour
Package And Shipping
