Product Description
3,5-Pyridinedicarboxylic acid, also known by its English name 3,5-Pyridinedicarboxylic Acid, is an organic chemical compound with the molecular formula C₇H₅NO₄. It is a pyridine-based dicarboxylic acid compound with defined chemical composition and structural characteristics.
Properties
| Melting point | >300 °C (lit.) |
| Boiling point | 295.67°C (rough estimate) |
| density | 1.5216 (rough estimate) |
| refractive index | 1.6280 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 1.0g/l |
| form | Powder |
| pka | 2.8(at 25℃) |
| color | White to almost white |
| Water Solubility | insoluble |
| BRN | 131640 |
| InChI | InChI=1S/C7H5NO4/c9-6(10)4-1-5(7(11)12)3-8-2-4/h1-3H,(H,9,10)(H,11,12) |
| InChIKey | MPFLRYZEEAQMLQ-UHFFFAOYSA-N |
| SMILES | C1=NC=C(C(O)=O)C=C1C(O)=O |
| CAS DataBase Reference | 499-81-0(CAS DataBase Reference) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-24/25-36/37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333999 |
Product Application
3,5-Pyridinedicarboxylic acid acts as a competitive inhibitor of butyrate hydroxylase and can be used in related biochemical research and applications.
Factory Tour
Package And Shipping
